C11H8N2O4 — CID 140663994
2-(1H-indol-5-ylmethyl)-1,3,2-dioxazolidine-4,5-dione (PubChem CID 140663994) has the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-(1H-indol-5-ylmethyl)-1,3,2-dioxazolidine-4,5-dione.
| Compound Name | 2-(1H-indol-5-ylmethyl)-1,3,2-dioxazolidine-4,5-dione |
|---|---|
| PubChem CID | 140663994 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-(1H-indol-5-ylmethyl)-1,3,2-dioxazolidine-4,5-dione |
| SMILES | O=c1on(Cc2ccc3[nH]ccc3c2)oc1=O |
| InChI | InChI=1S/C11H8N2O4/c14-10-11(15)17-13(16-10)6-7-1-2-9-8(5-7)3-4-12-9/h1-5,12H,6H2 |
| InChIKey | AVHXMRVXTQEZBW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|