C9H12N2O6S2 — CID 67052547
1H-indol-5-ylmethanesulfonamide;sulfuric acid (PubChem CID 67052547) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1H-indol-5-ylmethanesulfonamide;sulfuric acid.
| Compound Name | 1H-indol-5-ylmethanesulfonamide;sulfuric acid |
|---|---|
| PubChem CID | 67052547 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1H-indol-5-ylmethanesulfonamide;sulfuric acid |
| SMILES | NS(=O)(=O)Cc1ccc2[nH]ccc2c1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H10N2O2S.H2O4S/c10-14(12,13)6-7-1-2-9-8(5-7)3-4-11-9;1-5(2,3)4/h1-5,11H,6H2,(H2,10,12,13);(H2,1,2,3,4) |
| InChIKey | JMLUWMNMYIVVPD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|