C13H19FIN2- — CID 168949910
1-[(4-fluorophenyl)methyl]-4-methyliodanuidyl-1,4-diazepane (PubChem CID 168949910) has the molecular formula C13H19FIN2- and a molecular weight of 349.21 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-4-methyliodanuidyl-1,4-diazepane.
| Compound Name | 1-[(4-fluorophenyl)methyl]-4-methyliodanuidyl-1,4-diazepane |
|---|---|
| PubChem CID | 168949910 |
| Molecular Formula | C13H19FIN2- |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-4-methyliodanuidyl-1,4-diazepane |
| SMILES | C[I-]N1CCCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H19FIN2/c1-15-17-8-2-7-16(9-10-17)11-12-3-5-13(14)6-4-12/h3-6H,2,7-11H2,1H3/q-1 |
| InChIKey | FMDMGXDNADQOBK-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|