About 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole
4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole (PubChem CID 163967307) has the molecular formula C32H25F3N4
and a molecular weight of 522.57 g/mol. Its IUPAC name is 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole.
Molecular Properties
| Compound Name | 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole |
| PubChem CID | 163967307 |
| Molecular Formula | C32H25F3N4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole |
| SMILES | Fc1ccc2[nH]ccc2c1.Fc1ccc2cc[nH]c2c1.Fc1cccc2[nH]ccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/3C8H6FN.C8H7N/c9-7-1-2-8-6(5-7)3-4-10-8;9-7-2-1-6-3-4-10-8(6)5-7;9-7-2-1-3-8-6(7)4-5-10-8;1-2-4-8-7(3-1)5-6-9-8/h3*1-5,10H;1-6,9H |
| InChIKey | SMXXTQVTPJAOOO-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole?
The IUPAC name of 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole (CID 163967307) is 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole.
What is the SMILES notation for 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole?
The canonical SMILES for 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole is Fc1ccc2[nH]ccc2c1.Fc1ccc2cc[nH]c2c1.Fc1cccc2[nH]ccc12.c1ccc2[nH]ccc2c1.
What is the InChIKey of 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole?
The InChIKey is SMXXTQVTPJAOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H6FN.C8H7N/c9-7-1-2-8-6(5-7)3-4-10-8;9-7-2-1-6-3-4-10-8(6)5-7;9-7-2-1-3-8-6(7)4-5-10-8;1-2-4-8-7(3-1)5-6-9-8/h3*1-5,10H;1-6,9H.
What are the key properties of 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole?
4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole has a molecular weight of 522.57 g/mol, XLogP of 9.09, 0 rotatable bonds, 4 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1H-indole;5-fluoro-1H-indole;6-fluoro-1H-indole;1H-indole is sourced from PubChem (CID 163967307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).