C16H10FN3O — CID 162643919
5-(4-fluorophenyl)-3-(1H-indol-5-yl)-1,2,4-oxadiazole (PubChem CID 162643919) has the molecular formula C16H10FN3O and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-(1H-indol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-fluorophenyl)-3-(1H-indol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162643919 |
| Molecular Formula | C16H10FN3O |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-(4-fluorophenyl)-3-(1H-indol-5-yl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2nc(-c3ccc4[nH]ccc4c3)no2)cc1 |
| InChI | InChI=1S/C16H10FN3O/c17-13-4-1-10(2-5-13)16-19-15(20-21-16)12-3-6-14-11(9-12)7-8-18-14/h1-9,18H |
| InChIKey | RBFZMBTWOKIIPS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |