About 5-chloro-1H-indole;pyridine
5-chloro-1H-indole;pyridine (PubChem CID 175095575) has the molecular formula C13H11ClN2
and a molecular weight of 230.70 g/mol. Its IUPAC name is 5-chloro-1H-indole;pyridine.
Molecular Properties
| Compound Name | 5-chloro-1H-indole;pyridine |
| PubChem CID | 175095575 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 5-chloro-1H-indole;pyridine |
| SMILES | Clc1ccc2[nH]ccc2c1.c1ccncc1 |
| InChI | InChI=1S/C8H6ClN.C5H5N/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-4-6-5-3-1/h1-5,10H;1-5H |
| InChIKey | ILWKUSXRFQOFMR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-1H-indole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1H-indole;pyridine?
The IUPAC name of 5-chloro-1H-indole;pyridine (CID 175095575) is 5-chloro-1H-indole;pyridine.
What is the SMILES notation for 5-chloro-1H-indole;pyridine?
The canonical SMILES for 5-chloro-1H-indole;pyridine is Clc1ccc2[nH]ccc2c1.c1ccncc1.
What is the InChIKey of 5-chloro-1H-indole;pyridine?
The InChIKey is ILWKUSXRFQOFMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN.C5H5N/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-4-6-5-3-1/h1-5,10H;1-5H.
What are the key properties of 5-chloro-1H-indole;pyridine?
5-chloro-1H-indole;pyridine has a molecular weight of 230.70 g/mol, XLogP of 3.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1H-indole;pyridine is sourced from PubChem (CID 175095575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).