About pyridine;1H-pyrrolo[2,3-b]pyridine
pyridine;1H-pyrrolo[2,3-b]pyridine (PubChem CID 137361051) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is pyridine;1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | pyridine;1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 137361051 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | pyridine;1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccncc1.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.C5H5N/c1-2-6-3-5-9-7(6)8-4-1;1-2-4-6-5-3-1/h1-5H,(H,8,9);1-5H |
| InChIKey | LRRYUFALUBPDBU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyridine;1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of pyridine;1H-pyrrolo[2,3-b]pyridine (CID 137361051) is pyridine;1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for pyridine;1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for pyridine;1H-pyrrolo[2,3-b]pyridine is c1ccncc1.c1cnc2[nH]ccc2c1.
What is the InChIKey of pyridine;1H-pyrrolo[2,3-b]pyridine?
The InChIKey is LRRYUFALUBPDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C5H5N/c1-2-6-3-5-9-7(6)8-4-1;1-2-4-6-5-3-1/h1-5H,(H,8,9);1-5H.
What are the key properties of pyridine;1H-pyrrolo[2,3-b]pyridine?
pyridine;1H-pyrrolo[2,3-b]pyridine has a molecular weight of 197.24 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 137361051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).