C8H10N2S — CID 145094604
methanethiol;1H-pyrrolo[2,3-b]pyridine (PubChem CID 145094604) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is methanethiol;1H-pyrrolo[2,3-b]pyridine.
| Compound Name | methanethiol;1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 145094604 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | methanethiol;1H-pyrrolo[2,3-b]pyridine |
| SMILES | CS.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.CH4S/c1-2-6-3-5-9-7(6)8-4-1;1-2/h1-5H,(H,8,9);2H,1H3 |
| InChIKey | XUAOFJVMSXMKEX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|