C7H9N3 — CID 167479315
methane;1H-pyrazolo[5,4-b]pyridine (PubChem CID 167479315) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is methane;1H-pyrazolo[5,4-b]pyridine.
| Compound Name | methane;1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 167479315 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | methane;1H-pyrazolo[5,4-b]pyridine |
| SMILES | C.c1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C6H5N3.CH4/c1-2-5-4-8-9-6(5)7-3-1;/h1-4H,(H,7,8,9);1H4 |
| InChIKey | OXHONIYTTCOOKG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |