C7H10N4 — CID 143863701
methanamine;1H-pyrazolo[5,4-b]pyridine (PubChem CID 143863701) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is methanamine;1H-pyrazolo[5,4-b]pyridine.
| Compound Name | methanamine;1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 143863701 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | methanamine;1H-pyrazolo[5,4-b]pyridine |
| SMILES | CN.c1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C6H5N3.CH5N/c1-2-5-4-8-9-6(5)7-3-1;1-2/h1-4H,(H,7,8,9);2H2,1H3 |
| InChIKey | RGNOMBYUOSKLGA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |