C9H13N3 — CID 143926189
ethane;6-methyl-1H-pyrazolo[5,4-b]pyridine (PubChem CID 143926189) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;6-methyl-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | ethane;6-methyl-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 143926189 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;6-methyl-1H-pyrazolo[5,4-b]pyridine |
| SMILES | CC.Cc1ccc2cn[nH]c2n1 |
| InChI | InChI=1S/C7H7N3.C2H6/c1-5-2-3-6-4-8-10-7(6)9-5;1-2/h2-4H,1H3,(H,8,9,10);1-2H3 |
| InChIKey | FFPKDZSCLJZTMC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |