About 5-methyl-1H-pyrazolo[5,4-c]pyridazine
5-methyl-1H-pyrazolo[5,4-c]pyridazine (PubChem CID 144654603) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 5-methyl-1H-pyrazolo[5,4-c]pyridazine.
Molecular Properties
| Compound Name | 5-methyl-1H-pyrazolo[5,4-c]pyridazine |
| PubChem CID | 144654603 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 5-methyl-1H-pyrazolo[5,4-c]pyridazine |
| SMILES | Cc1cc2cn[nH]c2nn1 |
| InChI | InChI=1S/C6H6N4/c1-4-2-5-3-7-9-6(5)10-8-4/h2-3H,1H3,(H,7,9,10) |
| InChIKey | GLGPOBDRKYIZNN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1H-pyrazolo[5,4-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-pyrazolo[5,4-c]pyridazine?
The IUPAC name of 5-methyl-1H-pyrazolo[5,4-c]pyridazine (CID 144654603) is 5-methyl-1H-pyrazolo[5,4-c]pyridazine.
What is the SMILES notation for 5-methyl-1H-pyrazolo[5,4-c]pyridazine?
The canonical SMILES for 5-methyl-1H-pyrazolo[5,4-c]pyridazine is Cc1cc2cn[nH]c2nn1.
What is the InChIKey of 5-methyl-1H-pyrazolo[5,4-c]pyridazine?
The InChIKey is GLGPOBDRKYIZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-4-2-5-3-7-9-6(5)10-8-4/h2-3H,1H3,(H,7,9,10).
What are the key properties of 5-methyl-1H-pyrazolo[5,4-c]pyridazine?
5-methyl-1H-pyrazolo[5,4-c]pyridazine has a molecular weight of 134.14 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-pyrazolo[5,4-c]pyridazine is sourced from PubChem (CID 144654603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).