C10H15N3 — CID 176692042
ethane;5-ethyl-1H-pyrazolo[5,4-b]pyridine (PubChem CID 176692042) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is ethane;5-ethyl-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | ethane;5-ethyl-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 176692042 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | ethane;5-ethyl-1H-pyrazolo[5,4-b]pyridine |
| SMILES | CC.CCc1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-2-6-3-7-5-10-11-8(7)9-4-6;1-2/h3-5H,2H2,1H3,(H,9,10,11);1-2H3 |
| InChIKey | DTOBDBOJDOWCSV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |