C9H11N3 — CID 135080316
5-ethyl-1H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 135080316) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 5-ethyl-1H-pyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | 5-ethyl-1H-pyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 135080316 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 5-ethyl-1H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | CCc1cnc2[nH]cc(N)c2c1 |
| InChI | InChI=1S/C9H11N3/c1-2-6-3-7-8(10)5-12-9(7)11-4-6/h3-5H,2,10H2,1H3,(H,11,12) |
| InChIKey | YKOVJVPJSLZXNL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |