C17H17FN4O3S — CID 91515532
N-[4-amino-3-(5-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl]methanesulfonamide (PubChem CID 91515532) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[4-amino-3-(5-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[4-amino-3-(5-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91515532 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[4-amino-3-(5-ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl]methanesulfonamide |
| SMILES | CCc1cnc2[nH]cc(C(=O)c3c(N)ccc(NS(C)(=O)=O)c3F)c2c1 |
| InChI | InChI=1S/C17H17FN4O3S/c1-3-9-6-10-11(8-21-17(10)20-7-9)16(23)14-12(19)4-5-13(15(14)18)22-26(2,24)25/h4-8,22H,3,19H2,1-2H3,(H,20,21) |
| InChIKey | VIHRQQKZBYGVHW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|