C16H13BrFN3O — CID 162741571
(3-amino-2-ethyl-6-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 162741571) has the molecular formula C16H13BrFN3O and a molecular weight of 362.20 g/mol. Its IUPAC name is (3-amino-2-ethyl-6-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (3-amino-2-ethyl-6-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 162741571 |
| Molecular Formula | C16H13BrFN3O |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (3-amino-2-ethyl-6-fluorophenyl)-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | CCc1c(N)ccc(F)c1C(=O)c1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C16H13BrFN3O/c1-2-9-13(19)4-3-12(18)14(9)15(22)11-7-21-16-10(11)5-8(17)6-20-16/h3-7H,2,19H2,1H3,(H,20,21) |
| InChIKey | CHQHXFBQTJVSLT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|