C15H8F2N4O — CID 59569607
(3-amino-2,6-difluorophenyl)-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 59569607) has the molecular formula C15H8F2N4O and a molecular weight of 298.25 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 59569607 |
| Molecular Formula | C15H8F2N4O |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(5-isocyano-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | [C-]#[N+]c1cnc2[nH]cc(C(=O)c3c(F)ccc(N)c3F)c2c1 |
| InChI | InChI=1S/C15H8F2N4O/c1-19-7-4-8-9(6-21-15(8)20-5-7)14(22)12-10(16)2-3-11(18)13(12)17/h2-6H,18H2,(H,20,21) |
| InChIKey | APHAPBYMJXVHHG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|