C26H27F2N5O2 — CID 68755325
(3-amino-2,6-difluorophenyl)-[5-[6-[3-(diethylamino)propoxy]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 68755325) has the molecular formula C26H27F2N5O2 and a molecular weight of 479.53 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[5-[6-[3-(diethylamino)propoxy]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[5-[6-[3-(diethylamino)propoxy]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 68755325 |
| Molecular Formula | C26H27F2N5O2 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[5-[6-[3-(diethylamino)propoxy]-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CCN(CC)CCCOc1ccc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(N)c4F)c3c2)cn1 |
| InChI | InChI=1S/C26H27F2N5O2/c1-3-33(4-2)10-5-11-35-22-9-6-16(13-30-22)17-12-18-19(15-32-26(18)31-14-17)25(34)23-20(27)7-8-21(29)24(23)28/h6-9,12-15H,3-5,10-11,29H2,1-2H3,(H,31,32) |
| InChIKey | QADRMLIPXRBUAM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|