C22H13F2N5O — CID 89103743
(3-amino-2,6-difluorophenyl)-(5-quinazolin-6-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 89103743) has the molecular formula C22H13F2N5O and a molecular weight of 401.38 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-(5-quinazolin-6-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-(5-quinazolin-6-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 89103743 |
| Molecular Formula | C22H13F2N5O |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-(5-quinazolin-6-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc5ncncc5c4)cc23)c1F |
| InChI | InChI=1S/C22H13F2N5O/c23-16-2-3-17(25)20(24)19(16)21(30)15-9-28-22-14(15)6-12(8-27-22)11-1-4-18-13(5-11)7-26-10-29-18/h1-10H,25H2,(H,27,28) |
| InChIKey | VGFQAHBAALMWAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|