C20H12ClF2N3O — CID 68750642
(3-amino-2-chloro-6-fluorophenyl)-[5-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 68750642) has the molecular formula C20H12ClF2N3O and a molecular weight of 383.79 g/mol. Its IUPAC name is (3-amino-2-chloro-6-fluorophenyl)-[5-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2-chloro-6-fluorophenyl)-[5-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 68750642 |
| Molecular Formula | C20H12ClF2N3O |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (3-amino-2-chloro-6-fluorophenyl)-[5-(4-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc(F)cc4)cc23)c1Cl |
| InChI | InChI=1S/C20H12ClF2N3O/c21-18-16(24)6-5-15(23)17(18)19(27)14-9-26-20-13(14)7-11(8-25-20)10-1-3-12(22)4-2-10/h1-9H,24H2,(H,25,26) |
| InChIKey | VDOJVSYNEPBTBO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|