C19H15F2N5O — CID 68754499
(3-amino-2,6-difluorophenyl)-[5-(1,5-dimethylimidazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 68754499) has the molecular formula C19H15F2N5O and a molecular weight of 367.36 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[5-(1,5-dimethylimidazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[5-(1,5-dimethylimidazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 68754499 |
| Molecular Formula | C19H15F2N5O |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[5-(1,5-dimethylimidazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | Cc1cnc(-c2cnc3[nH]cc(C(=O)c4c(F)ccc(N)c4F)c3c2)n1C |
| InChI | InChI=1S/C19H15F2N5O/c1-9-6-25-19(26(9)2)10-5-11-12(8-24-18(11)23-7-10)17(27)15-13(20)3-4-14(22)16(15)21/h3-8H,22H2,1-2H3,(H,23,24) |
| InChIKey | TXNKYVONAKVTFJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|