C19H19F2N5O — CID 66647035
(3-amino-2,6-difluorophenyl)-[5-(4-methylpiperazin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 66647035) has the molecular formula C19H19F2N5O and a molecular weight of 371.39 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[5-(4-methylpiperazin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[5-(4-methylpiperazin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 66647035 |
| Molecular Formula | C19H19F2N5O |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[5-(4-methylpiperazin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CN1CCN(c2cnc3[nH]cc(C(=O)c4c(F)ccc(N)c4F)c3c2)CC1 |
| InChI | InChI=1S/C19H19F2N5O/c1-25-4-6-26(7-5-25)11-8-12-13(10-24-19(12)23-9-11)18(27)16-14(20)2-3-15(22)17(16)21/h2-3,8-10H,4-7,22H2,1H3,(H,23,24) |
| InChIKey | DHISYXPITCFALY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|