C21H18F2N4O3S — CID 88580347
N-[2,4-difluoro-3-(5-isocyano-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]cyclohexanesulfonamide (PubChem CID 88580347) has the molecular formula C21H18F2N4O3S and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[2,4-difluoro-3-(5-isocyano-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]cyclohexanesulfonamide.
| Compound Name | N-[2,4-difluoro-3-(5-isocyano-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 88580347 |
| Molecular Formula | C21H18F2N4O3S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[2,4-difluoro-3-(5-isocyano-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]cyclohexanesulfonamide |
| SMILES | [C-]#[N+]c1cnc2[nH]cc(C(=O)c3c(F)ccc(NS(=O)(=O)C4CCCCC4)c3F)c2c1 |
| InChI | InChI=1S/C21H18F2N4O3S/c1-24-12-9-14-15(11-26-21(14)25-10-12)20(28)18-16(22)7-8-17(19(18)23)27-31(29,30)13-5-3-2-4-6-13/h7-11,13,27H,2-6H2,(H,25,26) |
| InChIKey | VQEURSICBAAOIL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|