C26H21F2N5O3S — CID 123646981
3-[3-(dimethylsulfamoylamino)-2,6-difluorobenzoyl]-5-[4-(1-isocyanocyclopropyl)phenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 123646981) has the molecular formula C26H21F2N5O3S and a molecular weight of 521.55 g/mol. Its IUPAC name is 3-[3-(dimethylsulfamoylamino)-2,6-difluorobenzoyl]-5-[4-(1-isocyanocyclopropyl)phenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[3-(dimethylsulfamoylamino)-2,6-difluorobenzoyl]-5-[4-(1-isocyanocyclopropyl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 123646981 |
| Molecular Formula | C26H21F2N5O3S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 3-[3-(dimethylsulfamoylamino)-2,6-difluorobenzoyl]-5-[4-(1-isocyanocyclopropyl)phenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [C-]#[N+]C1(c2ccc(-c3cnc4[nH]cc(C(=O)c5c(F)ccc(NS(=O)(=O)N(C)C)c5F)c4c3)cc2)CC1 |
| InChI | InChI=1S/C26H21F2N5O3S/c1-29-26(10-11-26)17-6-4-15(5-7-17)16-12-18-19(14-31-25(18)30-13-16)24(34)22-20(27)8-9-21(23(22)28)32-37(35,36)33(2)3/h4-9,12-14,32H,10-11H2,2-3H3,(H,30,31) |
| InChIKey | ZLMCSJGIOXHDRP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|