C25H27BF3N3O5S — CID 153486037
(3R)-N-[2,4-difluoro-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorocyclopentane-1-sulfonamide (PubChem CID 153486037) has the molecular formula C25H27BF3N3O5S and a molecular weight of 549.38 g/mol. Its IUPAC name is (3R)-N-[2,4-difluoro-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorocyclopentane-1-sulfonamide.
| Compound Name | (3R)-N-[2,4-difluoro-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorocyclopentane-1-sulfonamide |
|---|---|
| PubChem CID | 153486037 |
| Molecular Formula | C25H27BF3N3O5S |
| Molecular Weight | 549.38 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3R)-N-[2,4-difluoro-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-3-fluorocyclopentane-1-sulfonamide |
| SMILES | CC1(C)OB(c2cnc3[nH]cc(C(=O)c4c(F)ccc(NS(=O)(=O)C5CC[C@@H](F)C5)c4F)c3c2)OC1(C)C |
| InChI | InChI=1S/C25H27BF3N3O5S/c1-24(2)25(3,4)37-26(36-24)13-9-16-17(12-31-23(16)30-11-13)22(33)20-18(28)7-8-19(21(20)29)32-38(34,35)15-6-5-14(27)10-15/h7-9,11-12,14-15,32H,5-6,10H2,1-4H3,(H,30,31)/t14-,15?/m1/s1 |
| InChIKey | KUIPNLFTOWGWCB-GICMACPYSA-N |
| XLogP | 4.00 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|