C13H13N7 — CID 161406896
6-methylpurin-6-amine;1H-pyrrolo[2,3-b]pyridine (PubChem CID 161406896) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is 6-methylpurin-6-amine;1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-methylpurin-6-amine;1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 161406896 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-methylpurin-6-amine;1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1(N)N=CN=C2N=CN=C21.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.C6H7N5/c1-2-6-3-5-9-7(6)8-4-1;1-6(7)4-5(9-2-8-4)10-3-11-6/h1-5H,(H,8,9);2-3H,7H2,1H3 |
| InChIKey | VUYPWANOYHKXQY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |