C14H15N3S — CID 145235638
4-methylsulfanylaniline;1H-pyrrolo[2,3-b]pyridine (PubChem CID 145235638) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-methylsulfanylaniline;1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-methylsulfanylaniline;1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 145235638 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-methylsulfanylaniline;1H-pyrrolo[2,3-b]pyridine |
| SMILES | CSc1ccc(N)cc1.c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.C7H9NS/c1-2-6-3-5-9-7(6)8-4-1;1-9-7-4-2-6(8)3-5-7/h1-5H,(H,8,9);2-5H,8H2,1H3 |
| InChIKey | DHVBXKNWANGTNT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|