C10H16N2 — CID 163390123
molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine (PubChem CID 163390123) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine.
| Compound Name | molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 163390123 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine |
| SMILES | CCC.[H][H].c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C7H6N2.C3H8.H2/c1-2-6-3-5-9-7(6)8-4-1;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H |
| InChIKey | OYEXCKBEGWNJCN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |