molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine

C10H16N2 — CID 163390123

IUPACmolecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine
SMILESCCC.[H][H].c1cnc2[nH]ccc2c1
InChIInChI=1S/C7H6N2.C3H8.H2/c1-2-6-3-5-9-7(6)8-4-1;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H
InChIKeyOYEXCKBEGWNJCN-UHFFFAOYSA-N
MW164.25 g/mol
LogP3.23
Rot. Bonds

About molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine

molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine (PubChem CID 163390123) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine.

Molecular Properties

Compound Namemolecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine
PubChem CID163390123
Molecular FormulaC10H16N2
Molecular Weight164.25 g/mol
Exact Mass164.13
IUPAC Namemolecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine
SMILESCCC.[H][H].c1cnc2[nH]ccc2c1
InChIInChI=1S/C7H6N2.C3H8.H2/c1-2-6-3-5-9-7(6)8-4-1;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H
InChIKeyOYEXCKBEGWNJCN-UHFFFAOYSA-N
XLogP3.23
TPSA28.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.25
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine (CID 163390123) is molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine is CCC.[H][H].c1cnc2[nH]ccc2c1.
What is the InChIKey of molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine?
The InChIKey is OYEXCKBEGWNJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C3H8.H2/c1-2-6-3-5-9-7(6)8-4-1;1-3-2;/h1-5H,(H,8,9);3H2,1-2H3;1H.
What are the key properties of molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine?
molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine has a molecular weight of 164.25 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;propane;1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 163390123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).