About ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine
ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 145385089) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 145385089 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC.CCc1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-2-8-6-7-4-3-5-10-9(7)11-8;1-2/h3-6H,2H2,1H3,(H,10,11);1-2H3 |
| InChIKey | VIGBEYDMEOMFSN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine (CID 145385089) is ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine is CC.CCc1cc2cccnc2[nH]1.
What is the InChIKey of ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is VIGBEYDMEOMFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C2H6/c1-2-8-6-7-4-3-5-10-9(7)11-8;1-2/h3-6H,2H2,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine?
ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 176.26 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 145385089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).