C11H16N2 — CID 145385089
ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 145385089) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 145385089 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | ethane;2-ethyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC.CCc1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-2-8-6-7-4-3-5-10-9(7)11-8;1-2/h3-6H,2H2,1H3,(H,10,11);1-2H3 |
| InChIKey | VIGBEYDMEOMFSN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |