About 2-ethenyl-1H-pyrrolo[2,3-b]pyridine
2-ethenyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 67281038) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2-ethenyl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-ethenyl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 67281038 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-ethenyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=Cc1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C9H8N2/c1-2-8-6-7-4-3-5-10-9(7)11-8/h2-6H,1H2,(H,10,11) |
| InChIKey | UBKWQZLNJAVJMT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-ethenyl-1H-pyrrolo[2,3-b]pyridine (CID 67281038) is 2-ethenyl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-ethenyl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-ethenyl-1H-pyrrolo[2,3-b]pyridine is C=Cc1cc2cccnc2[nH]1.
What is the InChIKey of 2-ethenyl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is UBKWQZLNJAVJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-8-6-7-4-3-5-10-9(7)11-8/h2-6H,1H2,(H,10,11).
What are the key properties of 2-ethenyl-1H-pyrrolo[2,3-b]pyridine?
2-ethenyl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 144.18 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 67281038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).