About 1,5-naphthyridine;pyridine
1,5-naphthyridine;pyridine (PubChem CID 158398713) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 1,5-naphthyridine;pyridine.
Molecular Properties
| Compound Name | 1,5-naphthyridine;pyridine |
| PubChem CID | 158398713 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,5-naphthyridine;pyridine |
| SMILES | c1ccncc1.c1cnc2cccnc2c1 |
| InChI | InChI=1S/C8H6N2.C5H5N/c1-3-7-8(9-5-1)4-2-6-10-7;1-2-4-6-5-3-1/h1-6H;1-5H |
| InChIKey | GXVMJKNYBICSEQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-naphthyridine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-naphthyridine;pyridine?
The IUPAC name of 1,5-naphthyridine;pyridine (CID 158398713) is 1,5-naphthyridine;pyridine.
What is the SMILES notation for 1,5-naphthyridine;pyridine?
The canonical SMILES for 1,5-naphthyridine;pyridine is c1ccncc1.c1cnc2cccnc2c1.
What is the InChIKey of 1,5-naphthyridine;pyridine?
The InChIKey is GXVMJKNYBICSEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C5H5N/c1-3-7-8(9-5-1)4-2-6-10-7;1-2-4-6-5-3-1/h1-6H;1-5H.
What are the key properties of 1,5-naphthyridine;pyridine?
1,5-naphthyridine;pyridine has a molecular weight of 209.25 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-naphthyridine;pyridine is sourced from PubChem (CID 158398713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).