About ethane;1,5-naphthyridine;propane
ethane;1,5-naphthyridine;propane (PubChem CID 142434189) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;1,5-naphthyridine;propane.
Molecular Properties
| Compound Name | ethane;1,5-naphthyridine;propane |
| PubChem CID | 142434189 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;1,5-naphthyridine;propane |
| SMILES | CC.CCC.c1cnc2cccnc2c1 |
| InChI | InChI=1S/C8H6N2.C3H8.C2H6/c1-3-7-8(9-5-1)4-2-6-10-7;1-3-2;1-2/h1-6H;3H2,1-2H3;1-2H3 |
| InChIKey | GEPFBNRGLOVBPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1,5-naphthyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,5-naphthyridine;propane?
The IUPAC name of ethane;1,5-naphthyridine;propane (CID 142434189) is ethane;1,5-naphthyridine;propane.
What is the SMILES notation for ethane;1,5-naphthyridine;propane?
The canonical SMILES for ethane;1,5-naphthyridine;propane is CC.CCC.c1cnc2cccnc2c1.
What is the InChIKey of ethane;1,5-naphthyridine;propane?
The InChIKey is GEPFBNRGLOVBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C3H8.C2H6/c1-3-7-8(9-5-1)4-2-6-10-7;1-3-2;1-2/h1-6H;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1,5-naphthyridine;propane?
ethane;1,5-naphthyridine;propane has a molecular weight of 204.32 g/mol, XLogP of 4.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,5-naphthyridine;propane is sourced from PubChem (CID 142434189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).