C9H11N3 — CID 91106587
ethane;pyrido[2,3-b]pyrazine (PubChem CID 91106587) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is ethane;pyrido[2,3-b]pyrazine.
| Compound Name | ethane;pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 91106587 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | ethane;pyrido[2,3-b]pyrazine |
| SMILES | CC.c1cnc2nccnc2c1 |
| InChI | InChI=1S/C7H5N3.C2H6/c1-2-6-7(9-3-1)10-5-4-8-6;1-2/h1-5H;1-2H3 |
| InChIKey | ISWMUXPVKOKVIG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |