C14H23N5O — CID 91339448
ethane;pyrido[2,3-b]pyrazine;1,1,3,3-tetramethylurea (PubChem CID 91339448) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is ethane;pyrido[2,3-b]pyrazine;1,1,3,3-tetramethylurea.
| Compound Name | ethane;pyrido[2,3-b]pyrazine;1,1,3,3-tetramethylurea |
|---|---|
| PubChem CID | 91339448 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | ethane;pyrido[2,3-b]pyrazine;1,1,3,3-tetramethylurea |
| SMILES | CC.CN(C)C(=O)N(C)C.c1cnc2nccnc2c1 |
| InChI | InChI=1S/C7H5N3.C5H12N2O.C2H6/c1-2-6-7(9-3-1)10-5-4-8-6;1-6(2)5(8)7(3)4;1-2/h1-5H;1-4H3;1-2H3 |
| InChIKey | RNQAZWXHUOHXFZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |