C10H13N3 — CID 144598223
ethane;2-methylpyrido[2,3-b]pyrazine (PubChem CID 144598223) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;2-methylpyrido[2,3-b]pyrazine.
| Compound Name | ethane;2-methylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 144598223 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | ethane;2-methylpyrido[2,3-b]pyrazine |
| SMILES | CC.Cc1cnc2ncccc2n1 |
| InChI | InChI=1S/C8H7N3.C2H6/c1-6-5-10-8-7(11-6)3-2-4-9-8;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | WKIMKZDFDAJPIH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |