About N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine
N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine (PubChem CID 58584195) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine |
| PubChem CID | 58584195 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine |
| SMILES | CC(C)N(C)c1cnc2ncccc2n1 |
| InChI | InChI=1S/C11H14N4/c1-8(2)15(3)10-7-13-11-9(14-10)5-4-6-12-11/h4-8H,1-3H3 |
| InChIKey | ZOHQLEFXEGLSJN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine?
The IUPAC name of N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine (CID 58584195) is N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine.
What is the SMILES notation for N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine?
The canonical SMILES for N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine is CC(C)N(C)c1cnc2ncccc2n1.
What is the InChIKey of N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine?
The InChIKey is ZOHQLEFXEGLSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c1-8(2)15(3)10-7-13-11-9(14-10)5-4-6-12-11/h4-8H,1-3H3.
What are the key properties of N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine?
N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine has a molecular weight of 202.26 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-propan-2-ylpyrido[2,3-b]pyrazin-2-amine is sourced from PubChem (CID 58584195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).