About 2H-oxazine;pyrido[2,3-b]pyrazine
2H-oxazine;pyrido[2,3-b]pyrazine (PubChem CID 174696231) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 2H-oxazine;pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 2H-oxazine;pyrido[2,3-b]pyrazine |
| PubChem CID | 174696231 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2H-oxazine;pyrido[2,3-b]pyrazine |
| SMILES | C1=CNOC=C1.c1cnc2nccnc2c1 |
| InChI | InChI=1S/C7H5N3.C4H5NO/c1-2-6-7(9-3-1)10-5-4-8-6;1-2-4-6-5-3-1/h1-5H;1-5H |
| InChIKey | SUZOQCJLZOOJNJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2H-oxazine;pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-oxazine;pyrido[2,3-b]pyrazine?
The IUPAC name of 2H-oxazine;pyrido[2,3-b]pyrazine (CID 174696231) is 2H-oxazine;pyrido[2,3-b]pyrazine.
What is the SMILES notation for 2H-oxazine;pyrido[2,3-b]pyrazine?
The canonical SMILES for 2H-oxazine;pyrido[2,3-b]pyrazine is C1=CNOC=C1.c1cnc2nccnc2c1.
What is the InChIKey of 2H-oxazine;pyrido[2,3-b]pyrazine?
The InChIKey is SUZOQCJLZOOJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3.C4H5NO/c1-2-6-7(9-3-1)10-5-4-8-6;1-2-4-6-5-3-1/h1-5H;1-5H.
What are the key properties of 2H-oxazine;pyrido[2,3-b]pyrazine?
2H-oxazine;pyrido[2,3-b]pyrazine has a molecular weight of 214.23 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-oxazine;pyrido[2,3-b]pyrazine is sourced from PubChem (CID 174696231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).