C14H11N5 — CID 175558542
1H-imidazo[4,5-b]pyridine;quinoxaline (PubChem CID 175558542) has the molecular formula C14H11N5 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridine;quinoxaline.
| Compound Name | 1H-imidazo[4,5-b]pyridine;quinoxaline |
|---|---|
| PubChem CID | 175558542 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridine;quinoxaline |
| SMILES | c1ccc2nccnc2c1.c1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H6N2.C6H5N3/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-5-6(7-3-1)9-4-8-5/h1-6H;1-4H,(H,7,8,9) |
| InChIKey | MXLQJNOAHIFXBL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |