About pyridine;2-pyrimidin-2-ylpyrimidine;quinoline
pyridine;2-pyrimidin-2-ylpyrimidine;quinoline (PubChem CID 175435300) has the molecular formula C22H18N6
and a molecular weight of 366.43 g/mol. Its IUPAC name is pyridine;2-pyrimidin-2-ylpyrimidine;quinoline.
Molecular Properties
| Compound Name | pyridine;2-pyrimidin-2-ylpyrimidine;quinoline |
| PubChem CID | 175435300 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | pyridine;2-pyrimidin-2-ylpyrimidine;quinoline |
| SMILES | c1ccc2ncccc2c1.c1ccncc1.c1cnc(-c2ncccn2)nc1 |
| InChI | InChI=1S/C9H7N.C8H6N4.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-9-7(10-4-1)8-11-5-2-6-12-8;1-2-4-6-5-3-1/h1-7H;1-6H;1-5H |
| InChIKey | ADLLPESVWPLIFH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyridine;2-pyrimidin-2-ylpyrimidine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;2-pyrimidin-2-ylpyrimidine;quinoline?
The IUPAC name of pyridine;2-pyrimidin-2-ylpyrimidine;quinoline (CID 175435300) is pyridine;2-pyrimidin-2-ylpyrimidine;quinoline.
What is the SMILES notation for pyridine;2-pyrimidin-2-ylpyrimidine;quinoline?
The canonical SMILES for pyridine;2-pyrimidin-2-ylpyrimidine;quinoline is c1ccc2ncccc2c1.c1ccncc1.c1cnc(-c2ncccn2)nc1.
What is the InChIKey of pyridine;2-pyrimidin-2-ylpyrimidine;quinoline?
The InChIKey is ADLLPESVWPLIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H6N4.C5H5N/c1-2-6-9-8(4-1)5-3-7-10-9;1-3-9-7(10-4-1)8-11-5-2-6-12-8;1-2-4-6-5-3-1/h1-7H;1-6H;1-5H.
What are the key properties of pyridine;2-pyrimidin-2-ylpyrimidine;quinoline?
pyridine;2-pyrimidin-2-ylpyrimidine;quinoline has a molecular weight of 366.43 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;2-pyrimidin-2-ylpyrimidine;quinoline is sourced from PubChem (CID 175435300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).