About benzo[b][1,5]naphthyridine;pyridine
benzo[b][1,5]naphthyridine;pyridine (PubChem CID 175337772) has the molecular formula C17H13N3
and a molecular weight of 259.31 g/mol. Its IUPAC name is benzo[b][1,5]naphthyridine;pyridine.
Molecular Properties
| Compound Name | benzo[b][1,5]naphthyridine;pyridine |
| PubChem CID | 175337772 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | benzo[b][1,5]naphthyridine;pyridine |
| SMILES | c1ccc2nc3cccnc3cc2c1.c1ccncc1 |
| InChI | InChI=1S/C12H8N2.C5H5N/c1-2-5-10-9(4-1)8-12-11(14-10)6-3-7-13-12;1-2-4-6-5-3-1/h1-8H;1-5H |
| InChIKey | ZSHBAMRMFNBTFR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze benzo[b][1,5]naphthyridine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b][1,5]naphthyridine;pyridine?
The IUPAC name of benzo[b][1,5]naphthyridine;pyridine (CID 175337772) is benzo[b][1,5]naphthyridine;pyridine.
What is the SMILES notation for benzo[b][1,5]naphthyridine;pyridine?
The canonical SMILES for benzo[b][1,5]naphthyridine;pyridine is c1ccc2nc3cccnc3cc2c1.c1ccncc1.
What is the InChIKey of benzo[b][1,5]naphthyridine;pyridine?
The InChIKey is ZSHBAMRMFNBTFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C5H5N/c1-2-5-10-9(4-1)8-12-11(14-10)6-3-7-13-12;1-2-4-6-5-3-1/h1-8H;1-5H.
What are the key properties of benzo[b][1,5]naphthyridine;pyridine?
benzo[b][1,5]naphthyridine;pyridine has a molecular weight of 259.31 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b][1,5]naphthyridine;pyridine is sourced from PubChem (CID 175337772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).