C14H8S3 — CID 25213369
2-thiophen-2-ylthieno[2,3-f][1]benzothiole (PubChem CID 25213369) has the molecular formula C14H8S3 and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-thiophen-2-ylthieno[2,3-f][1]benzothiole.
| Compound Name | 2-thiophen-2-ylthieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 25213369 |
| Molecular Formula | C14H8S3 |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-thiophen-2-ylthieno[2,3-f][1]benzothiole |
| SMILES | c1csc(-c2cc3cc4sccc4cc3s2)c1 |
| InChI | InChI=1S/C14H8S3/c1-2-11(15-4-1)14-8-10-7-12-9(3-5-16-12)6-13(10)17-14/h1-8H |
| InChIKey | CRNSYJHQQDLZNT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |