C23H28O2 — CID 59168492
1-but-3-enoxy-4-[2-(4-but-3-enoxyphenyl)propan-2-yl]benzene (PubChem CID 59168492) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[2-(4-but-3-enoxyphenyl)propan-2-yl]benzene.
| Compound Name | 1-but-3-enoxy-4-[2-(4-but-3-enoxyphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 59168492 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-but-3-enoxy-4-[2-(4-but-3-enoxyphenyl)propan-2-yl]benzene |
| SMILES | C=CCCOc1ccc(C(C)(C)c2ccc(OCCC=C)cc2)cc1 |
| InChI | InChI=1S/C23H28O2/c1-5-7-17-24-21-13-9-19(10-14-21)23(3,4)20-11-15-22(16-12-20)25-18-8-6-2/h5-6,9-16H,1-2,7-8,17-18H2,3-4H3 |
| InChIKey | HRHJXEGZQZOZQK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|