C104H108O8 — CID 158223803
1-but-3-enoxy-4-[1-[4-[4-[4-[1-(4-but-3-enoxyphenyl)-1-phenylethyl]phenoxy]butoxy]phenyl]-1-phenylethyl]benzene (PubChem CID 158223803) has the molecular formula C104H108O8 and a molecular weight of 1486.00 g/mol. Its IUPAC name is 1-but-3-enoxy-4-[1-[4-[4-[4-[1-(4-but-3-enoxyphenyl)-1-phenylethyl]phenoxy]butoxy]phenyl]-1-phenylethyl]benzene.
| Compound Name | 1-but-3-enoxy-4-[1-[4-[4-[4-[1-(4-but-3-enoxyphenyl)-1-phenylethyl]phenoxy]butoxy]phenyl]-1-phenylethyl]benzene |
|---|---|
| PubChem CID | 158223803 |
| Molecular Formula | C104H108O8 |
| Molecular Weight | 1486.00 g/mol |
| Exact Mass | 1484.80 |
| IUPAC Name | 1-but-3-enoxy-4-[1-[4-[4-[4-[1-(4-but-3-enoxyphenyl)-1-phenylethyl]phenoxy]butoxy]phenyl]-1-phenylethyl]benzene |
| SMILES | C=CCCOc1ccc(C(C)(c2ccccc2)c2ccc(OCCCCOc3ccc(C(C)(c4ccccc4)c4ccc(OCCC=C)cc4)cc3)cc2)cc1.C=CCCOc1ccc(C(C)(c2ccccc2)c2ccc(OCCCCOc3ccc(C(C)(c4ccccc4)c4ccc(OCCC=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/2C52H54O4/c2*1-5-7-37-53-47-29-21-43(22-30-47)51(3,41-17-11-9-12-18-41)45-25-33-49(34-26-45)55-39-15-16-40-56-50-35-27-46(28-36-50)52(4,42-19-13-10-14-20-42)44-23-31-48(32-24-44)54-38-8-6-2/h2*5-6,9-14,17-36H,1-2,7-8,15-16,37-40H2,3-4H3 |
| InChIKey | GDOGGTWDSDOXAY-UHFFFAOYSA-N |
| XLogP | 25.09 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 112 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1486.00 |
| LogP ≤ 5 | 25.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|