C59H68O4 — CID 143165098
1-(3-ethylhex-5-en-3-yloxy)-4-[1-[4-[4-ethyl-4-[4-[1-phenyl-1-(4-prop-2-enoxyphenyl)ethyl]phenoxy]hexoxy]phenyl]-1-phenylethyl]benzene (PubChem CID 143165098) has the molecular formula C59H68O4 and a molecular weight of 841.19 g/mol. Its IUPAC name is 1-(3-ethylhex-5-en-3-yloxy)-4-[1-[4-[4-ethyl-4-[4-[1-phenyl-1-(4-prop-2-enoxyphenyl)ethyl]phenoxy]hexoxy]phenyl]-1-phenylethyl]benzene.
| Compound Name | 1-(3-ethylhex-5-en-3-yloxy)-4-[1-[4-[4-ethyl-4-[4-[1-phenyl-1-(4-prop-2-enoxyphenyl)ethyl]phenoxy]hexoxy]phenyl]-1-phenylethyl]benzene |
|---|---|
| PubChem CID | 143165098 |
| Molecular Formula | C59H68O4 |
| Molecular Weight | 841.19 g/mol |
| Exact Mass | 840.51 |
| IUPAC Name | 1-(3-ethylhex-5-en-3-yloxy)-4-[1-[4-[4-ethyl-4-[4-[1-phenyl-1-(4-prop-2-enoxyphenyl)ethyl]phenoxy]hexoxy]phenyl]-1-phenylethyl]benzene |
| SMILES | C=CCOc1ccc(C(C)(c2ccccc2)c2ccc(OC(CC)(CC)CCCOc3ccc(C(C)(c4ccccc4)c4ccc(OC(CC)(CC)CC=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H68O4/c1-9-42-58(11-3,12-4)62-54-38-30-50(31-39-54)57(8,47-24-19-16-20-25-47)49-28-36-53(37-29-49)61-45-21-43-59(13-5,14-6)63-55-40-32-51(33-41-55)56(7,46-22-17-15-18-23-46)48-26-34-52(35-27-48)60-44-10-2/h9-10,15-20,22-41H,1-2,11-14,21,42-45H2,3-8H3 |
| InChIKey | SEPXVUGMVOZZBN-UHFFFAOYSA-N |
| XLogP | 15.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.19 |
| LogP ≤ 5 | 15.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|