C17H26FIO — CID 11079706
1,5-ditert-butyl-2-(3-fluoropropoxy)-3-iodobenzene (PubChem CID 11079706) has the molecular formula C17H26FIO and a molecular weight of 392.30 g/mol. Its IUPAC name is 1,5-ditert-butyl-2-(3-fluoropropoxy)-3-iodobenzene.
| Compound Name | 1,5-ditert-butyl-2-(3-fluoropropoxy)-3-iodobenzene |
|---|---|
| PubChem CID | 11079706 |
| Molecular Formula | C17H26FIO |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1,5-ditert-butyl-2-(3-fluoropropoxy)-3-iodobenzene |
| SMILES | CC(C)(C)c1cc(I)c(OCCCF)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26FIO/c1-16(2,3)12-10-13(17(4,5)6)15(14(19)11-12)20-9-7-8-18/h10-11H,7-9H2,1-6H3 |
| InChIKey | DPRMTPWSTTULLY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|