C30H46FO2P — CID 54348247
bis(2,4-ditert-butyl-6-methylphenoxy)-fluorophosphane (PubChem CID 54348247) has the molecular formula C30H46FO2P and a molecular weight of 488.67 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-6-methylphenoxy)-fluorophosphane.
| Compound Name | bis(2,4-ditert-butyl-6-methylphenoxy)-fluorophosphane |
|---|---|
| PubChem CID | 54348247 |
| Molecular Formula | C30H46FO2P |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | bis(2,4-ditert-butyl-6-methylphenoxy)-fluorophosphane |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1OP(F)Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C30H46FO2P/c1-19-15-21(27(3,4)5)17-23(29(9,10)11)25(19)32-34(31)33-26-20(2)16-22(28(6,7)8)18-24(26)30(12,13)14/h15-18H,1-14H3 |
| InChIKey | UDVBYOKYLORRTB-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|