C20H32FO2P — CID 166718025
(2,4-ditert-butyl-6-propan-2-ylphenoxy)-fluoro-prop-1-en-2-yloxyphosphane (PubChem CID 166718025) has the molecular formula C20H32FO2P and a molecular weight of 354.45 g/mol. Its IUPAC name is (2,4-ditert-butyl-6-propan-2-ylphenoxy)-fluoro-prop-1-en-2-yloxyphosphane.
| Compound Name | (2,4-ditert-butyl-6-propan-2-ylphenoxy)-fluoro-prop-1-en-2-yloxyphosphane |
|---|---|
| PubChem CID | 166718025 |
| Molecular Formula | C20H32FO2P |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (2,4-ditert-butyl-6-propan-2-ylphenoxy)-fluoro-prop-1-en-2-yloxyphosphane |
| SMILES | C=C(C)OP(F)Oc1c(C(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H32FO2P/c1-13(2)16-11-15(19(5,6)7)12-17(20(8,9)10)18(16)23-24(21)22-14(3)4/h11-13H,3H2,1-2,4-10H3 |
| InChIKey | OEGMPYMSGMXRLC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|