C30H46FO3P — CID 22998694
[2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenoxy]-fluorophosphinous acid (PubChem CID 22998694) has the molecular formula C30H46FO3P and a molecular weight of 504.67 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenoxy]-fluorophosphinous acid.
| Compound Name | [2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenoxy]-fluorophosphinous acid |
|---|---|
| PubChem CID | 22998694 |
| Molecular Formula | C30H46FO3P |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenoxy]-fluorophosphinous acid |
| SMILES | CC(C)(C)c1cc(CCc2cc(C(C)(C)C)cc(C(C)(C)C)c2OP(O)F)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H46FO3P/c1-27(2,3)21-15-19(25(32)23(17-21)29(7,8)9)13-14-20-16-22(28(4,5)6)18-24(30(10,11)12)26(20)34-35(31)33/h15-18,32-33H,13-14H2,1-12H3 |
| InChIKey | HOJMVENSKOMCMQ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|