C36H60O4Si — CID 101416642
dihydroxy-bis(2,4,6-tritert-butylphenoxy)silane (PubChem CID 101416642) has the molecular formula C36H60O4Si and a molecular weight of 584.96 g/mol. Its IUPAC name is dihydroxy-bis(2,4,6-tritert-butylphenoxy)silane.
| Compound Name | dihydroxy-bis(2,4,6-tritert-butylphenoxy)silane |
|---|---|
| PubChem CID | 101416642 |
| Molecular Formula | C36H60O4Si |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | dihydroxy-bis(2,4,6-tritert-butylphenoxy)silane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O[Si](O)(O)Oc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H60O4Si/c1-31(2,3)23-19-25(33(7,8)9)29(26(20-23)34(10,11)12)39-41(37,38)40-30-27(35(13,14)15)21-24(32(4,5)6)22-28(30)36(16,17)18/h19-22,37-38H,1-18H3 |
| InChIKey | FMWVENYJYYIZMV-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|