C51H75N3O3 — CID 132609953
2,4,6-tris[(3,5-ditert-butyl-2-methoxyphenyl)methyl]-1,3,5-triazine (PubChem CID 132609953) has the molecular formula C51H75N3O3 and a molecular weight of 778.18 g/mol. Its IUPAC name is 2,4,6-tris[(3,5-ditert-butyl-2-methoxyphenyl)methyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[(3,5-ditert-butyl-2-methoxyphenyl)methyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 132609953 |
| Molecular Formula | C51H75N3O3 |
| Molecular Weight | 778.18 g/mol |
| Exact Mass | 777.58 |
| IUPAC Name | 2,4,6-tris[(3,5-ditert-butyl-2-methoxyphenyl)methyl]-1,3,5-triazine |
| SMILES | COc1c(Cc2nc(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3OC)nc(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3OC)n2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C51H75N3O3/c1-46(2,3)34-22-31(43(55-19)37(28-34)49(10,11)12)25-40-52-41(26-32-23-35(47(4,5)6)29-38(44(32)56-20)50(13,14)15)54-42(53-40)27-33-24-36(48(7,8)9)30-39(45(33)57-21)51(16,17)18/h22-24,28-30H,25-27H2,1-21H3 |
| InChIKey | AOZWSSNNZYACFJ-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.18 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |